About 3-[2-(5,5-dimethyloxolan-2-yl)ethyl]pyridin-2-amine
3-[2-(5,5-dimethyloxolan-2-yl)ethyl]pyridin-2-amine (PubChem CID 116524139) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-[2-(5,5-dimethyloxolan-2-yl)ethyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-[2-(5,5-dimethyloxolan-2-yl)ethyl]pyridin-2-amine |
| PubChem CID | 116524139 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-[2-(5,5-dimethyloxolan-2-yl)ethyl]pyridin-2-amine |
| SMILES | CC1(C)CCC(CCc2cccnc2N)O1 |
| InChI | InChI=1S/C13H20N2O/c1-13(2)8-7-11(16-13)6-5-10-4-3-9-15-12(10)14/h3-4,9,11H,5-8H2,1-2H3,(H2,14,15) |
| InChIKey | DWLMYBGBVZNVOS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(5,5-dimethyloxolan-2-yl)ethyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(5,5-dimethyloxolan-2-yl)ethyl]pyridin-2-amine?
The IUPAC name of 3-[2-(5,5-dimethyloxolan-2-yl)ethyl]pyridin-2-amine (CID 116524139) is 3-[2-(5,5-dimethyloxolan-2-yl)ethyl]pyridin-2-amine.
What is the SMILES notation for 3-[2-(5,5-dimethyloxolan-2-yl)ethyl]pyridin-2-amine?
The canonical SMILES for 3-[2-(5,5-dimethyloxolan-2-yl)ethyl]pyridin-2-amine is CC1(C)CCC(CCc2cccnc2N)O1.
What is the InChIKey of 3-[2-(5,5-dimethyloxolan-2-yl)ethyl]pyridin-2-amine?
The InChIKey is DWLMYBGBVZNVOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-13(2)8-7-11(16-13)6-5-10-4-3-9-15-12(10)14/h3-4,9,11H,5-8H2,1-2H3,(H2,14,15).
What are the key properties of 3-[2-(5,5-dimethyloxolan-2-yl)ethyl]pyridin-2-amine?
3-[2-(5,5-dimethyloxolan-2-yl)ethyl]pyridin-2-amine has a molecular weight of 220.32 g/mol, XLogP of 2.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(5,5-dimethyloxolan-2-yl)ethyl]pyridin-2-amine is sourced from PubChem (CID 116524139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).