About [4-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenyl]methanamine
[4-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenyl]methanamine (PubChem CID 116524182) has the molecular formula C14H21NOS
and a molecular weight of 251.39 g/mol. Its IUPAC name is [4-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenyl]methanamine.
Molecular Properties
| Compound Name | [4-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenyl]methanamine |
| PubChem CID | 116524182 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | [4-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenyl]methanamine |
| SMILES | CC1(C)CCC(CSc2ccc(CN)cc2)O1 |
| InChI | InChI=1S/C14H21NOS/c1-14(2)8-7-12(16-14)10-17-13-5-3-11(9-15)4-6-13/h3-6,12H,7-10,15H2,1-2H3 |
| InChIKey | MYSVXFQITHFXJG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenyl]methanamine?
The IUPAC name of [4-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenyl]methanamine (CID 116524182) is [4-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenyl]methanamine.
What is the SMILES notation for [4-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenyl]methanamine?
The canonical SMILES for [4-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenyl]methanamine is CC1(C)CCC(CSc2ccc(CN)cc2)O1.
What is the InChIKey of [4-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenyl]methanamine?
The InChIKey is MYSVXFQITHFXJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NOS/c1-14(2)8-7-12(16-14)10-17-13-5-3-11(9-15)4-6-13/h3-6,12H,7-10,15H2,1-2H3.
What are the key properties of [4-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenyl]methanamine?
[4-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenyl]methanamine has a molecular weight of 251.39 g/mol, XLogP of 3.19, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(5,5-dimethyloxolan-2-yl)methylsulfanyl]phenyl]methanamine is sourced from PubChem (CID 116524182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).