C15H18O7 — CID 11652498
dimethyl (1R,4S)-7,7-dimethoxy-5-methyl-8-oxobicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate (PubChem CID 11652498) has the molecular formula C15H18O7 and a molecular weight of 310.30 g/mol. Its IUPAC name is dimethyl (1R,4S)-7,7-dimethoxy-5-methyl-8-oxobicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl (1R,4S)-7,7-dimethoxy-5-methyl-8-oxobicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11652498 |
| Molecular Formula | C15H18O7 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | dimethyl (1R,4S)-7,7-dimethoxy-5-methyl-8-oxobicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H]2C=C(C)[C@@H]1C(=O)C2(OC)OC |
| InChI | InChI=1S/C15H18O7/c1-7-6-8-10(13(17)19-2)11(14(18)20-3)9(7)12(16)15(8,21-4)22-5/h6,8-9H,1-5H3/t8-,9+/m1/s1 |
| InChIKey | OHHVKBTXLCXFNN-BDAKNGLRSA-N |
| XLogP | 0.39 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|