C17H24Br2O — CID 116525338
5-[3-bromo-2-(bromomethyl)-2-(4-methylphenyl)propyl]-2,2-dimethyloxolane (PubChem CID 116525338) has the molecular formula C17H24Br2O and a molecular weight of 404.19 g/mol. Its IUPAC name is 5-[3-bromo-2-(bromomethyl)-2-(4-methylphenyl)propyl]-2,2-dimethyloxolane.
| Compound Name | 5-[3-bromo-2-(bromomethyl)-2-(4-methylphenyl)propyl]-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 116525338 |
| Molecular Formula | C17H24Br2O |
| Molecular Weight | 404.19 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 5-[3-bromo-2-(bromomethyl)-2-(4-methylphenyl)propyl]-2,2-dimethyloxolane |
| SMILES | Cc1ccc(C(CBr)(CBr)CC2CCC(C)(C)O2)cc1 |
| InChI | InChI=1S/C17H24Br2O/c1-13-4-6-14(7-5-13)17(11-18,12-19)10-15-8-9-16(2,3)20-15/h4-7,15H,8-12H2,1-3H3 |
| InChIKey | DBUHLUSELXAVJA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.19 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|