C17H23ClO — CID 116525782
2-chloro-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-1-one (PubChem CID 116525782) has the molecular formula C17H23ClO and a molecular weight of 278.82 g/mol. Its IUPAC name is 2-chloro-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-1-one.
| Compound Name | 2-chloro-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-1-one |
|---|---|
| PubChem CID | 116525782 |
| Molecular Formula | C17H23ClO |
| Molecular Weight | 278.82 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-chloro-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-1-one |
| SMILES | CC(Cl)C(=O)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C17H23ClO/c1-11(18)15(19)12-6-7-13-14(10-12)17(4,5)9-8-16(13,2)3/h6-7,10-11H,8-9H2,1-5H3 |
| InChIKey | CBZRPLLIGWOKRM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.82 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|