C20H31N — CID 116525983
N,4,5,5,8,8-hexamethyl-1,2,3,4,6,7-hexahydroanthracen-1-amine (PubChem CID 116525983) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is N,4,5,5,8,8-hexamethyl-1,2,3,4,6,7-hexahydroanthracen-1-amine.
| Compound Name | N,4,5,5,8,8-hexamethyl-1,2,3,4,6,7-hexahydroanthracen-1-amine |
|---|---|
| PubChem CID | 116525983 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | N,4,5,5,8,8-hexamethyl-1,2,3,4,6,7-hexahydroanthracen-1-amine |
| SMILES | CNC1CCC(C)c2cc3c(cc21)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C20H31N/c1-13-7-8-18(21-6)15-12-17-16(11-14(13)15)19(2,3)9-10-20(17,4)5/h11-13,18,21H,7-10H2,1-6H3 |
| InChIKey | QGKLTGDVTBAHOQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |