C16H21N3O2S — CID 11652659
(4R,5R)-N-cyclohexyl-4-methyl-5-pyridin-2-yl-2-sulfanylidene-1,3-oxazolidine-3-carboxamide (PubChem CID 11652659) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is (4R,5R)-N-cyclohexyl-4-methyl-5-pyridin-2-yl-2-sulfanylidene-1,3-oxazolidine-3-carboxamide.
| Compound Name | (4R,5R)-N-cyclohexyl-4-methyl-5-pyridin-2-yl-2-sulfanylidene-1,3-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 11652659 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (4R,5R)-N-cyclohexyl-4-methyl-5-pyridin-2-yl-2-sulfanylidene-1,3-oxazolidine-3-carboxamide |
| SMILES | C[C@@H]1[C@H](c2ccccn2)OC(=S)N1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H21N3O2S/c1-11-14(13-9-5-6-10-17-13)21-16(22)19(11)15(20)18-12-7-3-2-4-8-12/h5-6,9-12,14H,2-4,7-8H2,1H3,(H,18,20)/t11-,14-/m1/s1 |
| InChIKey | YYQOOBUKOKFEHA-BXUZGUMPSA-N |
| XLogP | 3.17 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|