C17H14Cl2O2 — CID 11652686
7,7'-dichloro-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol (PubChem CID 11652686) has the molecular formula C17H14Cl2O2 and a molecular weight of 321.20 g/mol. Its IUPAC name is 7,7'-dichloro-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol.
| Compound Name | 7,7'-dichloro-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol |
|---|---|
| PubChem CID | 11652686 |
| Molecular Formula | C17H14Cl2O2 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 7,7'-dichloro-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol |
| SMILES | Oc1ccc(Cl)c2c1C1(CC2)CCc2c(Cl)ccc(O)c21 |
| InChI | InChI=1S/C17H14Cl2O2/c18-11-1-3-13(20)15-9(11)5-7-17(15)8-6-10-12(19)2-4-14(21)16(10)17/h1-4,20-21H,5-8H2 |
| InChIKey | DKVRZZWMRGJNGA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |