C13H22N2O2S2 — CID 116527146
ethyl 2-(4-ethylsulfanylbutan-2-ylamino)-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 116527146) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.47 g/mol. Its IUPAC name is ethyl 2-(4-ethylsulfanylbutan-2-ylamino)-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(4-ethylsulfanylbutan-2-ylamino)-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 116527146 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | ethyl 2-(4-ethylsulfanylbutan-2-ylamino)-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(NC(C)CCSCC)sc1C |
| InChI | InChI=1S/C13H22N2O2S2/c1-5-17-12(16)11-10(4)19-13(15-11)14-9(3)7-8-18-6-2/h9H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | GSBWSYUYRICXFA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|