C12H15BrFNO4S — CID 116527347
2-[(4-bromo-2-fluorophenyl)sulfonyl-ethylamino]-2-methylpropanoic acid (PubChem CID 116527347) has the molecular formula C12H15BrFNO4S and a molecular weight of 368.22 g/mol. Its IUPAC name is 2-[(4-bromo-2-fluorophenyl)sulfonyl-ethylamino]-2-methylpropanoic acid.
| Compound Name | 2-[(4-bromo-2-fluorophenyl)sulfonyl-ethylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 116527347 |
| Molecular Formula | C12H15BrFNO4S |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 2-[(4-bromo-2-fluorophenyl)sulfonyl-ethylamino]-2-methylpropanoic acid |
| SMILES | CCN(C(C)(C)C(=O)O)S(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C12H15BrFNO4S/c1-4-15(12(2,3)11(16)17)20(18,19)10-6-5-8(13)7-9(10)14/h5-7H,4H2,1-3H3,(H,16,17) |
| InChIKey | OKJPDJLNSHEISG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |