C18H28O4Si — CID 11652946
(4S,4aR,5S,9aR)-9a-hydroxy-3,4a,5-trimethyl-4-trimethylsilyloxy-5,6,7,9-tetrahydro-4H-benzo[f][1]benzofuran-2-one (PubChem CID 11652946) has the molecular formula C18H28O4Si and a molecular weight of 336.50 g/mol. Its IUPAC name is (4S,4aR,5S,9aR)-9a-hydroxy-3,4a,5-trimethyl-4-trimethylsilyloxy-5,6,7,9-tetrahydro-4H-benzo[f][1]benzofuran-2-one.
| Compound Name | (4S,4aR,5S,9aR)-9a-hydroxy-3,4a,5-trimethyl-4-trimethylsilyloxy-5,6,7,9-tetrahydro-4H-benzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 11652946 |
| Molecular Formula | C18H28O4Si |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (4S,4aR,5S,9aR)-9a-hydroxy-3,4a,5-trimethyl-4-trimethylsilyloxy-5,6,7,9-tetrahydro-4H-benzo[f][1]benzofuran-2-one |
| SMILES | CC1=C2[C@@H](O[Si](C)(C)C)[C@@]3(C)C(=CCC[C@@H]3C)C[C@@]2(O)OC1=O |
| InChI | InChI=1S/C18H28O4Si/c1-11-8-7-9-13-10-18(20)14(12(2)16(19)21-18)15(17(11,13)3)22-23(4,5)6/h9,11,15,20H,7-8,10H2,1-6H3/t11-,15+,17+,18+/m0/s1 |
| InChIKey | IICOMTMTVIYXHQ-GJDZTLJBSA-N |
| XLogP | 3.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|