C11H15BrFN3O3S — CID 116529743
3-[(4-bromo-2-fluorophenyl)sulfonyl-methylamino]-N'-hydroxybutanimidamide (PubChem CID 116529743) has the molecular formula C11H15BrFN3O3S and a molecular weight of 368.23 g/mol. Its IUPAC name is 3-[(4-bromo-2-fluorophenyl)sulfonyl-methylamino]-N'-hydroxybutanimidamide.
| Compound Name | 3-[(4-bromo-2-fluorophenyl)sulfonyl-methylamino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 116529743 |
| Molecular Formula | C11H15BrFN3O3S |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | 3-[(4-bromo-2-fluorophenyl)sulfonyl-methylamino]-N'-hydroxybutanimidamide |
| SMILES | CC(C/C(N)=N/O)N(C)S(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C11H15BrFN3O3S/c1-7(5-11(14)15-17)16(2)20(18,19)10-4-3-8(12)6-9(10)13/h3-4,6-7,17H,5H2,1-2H3,(H2,14,15) |
| InChIKey | AEPNMBHYWHCDLP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|