C18H16O5S — CID 11653094
1-(3,4-dimethoxyphenyl)-3-(4-methylsulfonylphenyl)prop-2-yn-1-one (PubChem CID 11653094) has the molecular formula C18H16O5S and a molecular weight of 344.39 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(4-methylsulfonylphenyl)prop-2-yn-1-one.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(4-methylsulfonylphenyl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 11653094 |
| Molecular Formula | C18H16O5S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(4-methylsulfonylphenyl)prop-2-yn-1-one |
| SMILES | COc1ccc(C(=O)C#Cc2ccc(S(C)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C18H16O5S/c1-22-17-11-7-14(12-18(17)23-2)16(19)10-6-13-4-8-15(9-5-13)24(3,20)21/h4-5,7-9,11-12H,1-3H3 |
| InChIKey | OZHWLRKHAHPLNY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|