C17H10FNO2 — CID 116531149
2-fluoro-11H-indeno[1,2-b]quinoline-10-carboxylic acid (PubChem CID 116531149) has the molecular formula C17H10FNO2 and a molecular weight of 279.27 g/mol. Its IUPAC name is 2-fluoro-11H-indeno[1,2-b]quinoline-10-carboxylic acid.
| Compound Name | 2-fluoro-11H-indeno[1,2-b]quinoline-10-carboxylic acid |
|---|---|
| PubChem CID | 116531149 |
| Molecular Formula | C17H10FNO2 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-fluoro-11H-indeno[1,2-b]quinoline-10-carboxylic acid |
| SMILES | O=C(O)c1c2c(nc3ccccc13)-c1ccc(F)cc1C2 |
| InChI | InChI=1S/C17H10FNO2/c18-10-5-6-11-9(7-10)8-13-15(17(20)21)12-3-1-2-4-14(12)19-16(11)13/h1-7H,8H2,(H,20,21) |
| InChIKey | WXQOVFPALVJSDA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |