About 5-fluoro-1-prop-2-enyl-2,3-dihydroinden-1-ol
5-fluoro-1-prop-2-enyl-2,3-dihydroinden-1-ol (PubChem CID 116531622) has the molecular formula C12H13FO
and a molecular weight of 192.23 g/mol. Its IUPAC name is 5-fluoro-1-prop-2-enyl-2,3-dihydroinden-1-ol.
Molecular Properties
| Compound Name | 5-fluoro-1-prop-2-enyl-2,3-dihydroinden-1-ol |
| PubChem CID | 116531622 |
| Molecular Formula | C12H13FO |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 5-fluoro-1-prop-2-enyl-2,3-dihydroinden-1-ol |
| SMILES | C=CCC1(O)CCc2cc(F)ccc21 |
| InChI | InChI=1S/C12H13FO/c1-2-6-12(14)7-5-9-8-10(13)3-4-11(9)12/h2-4,8,14H,1,5-7H2 |
| InChIKey | TZDQPHZCDDPFCN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-1-prop-2-enyl-2,3-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1-prop-2-enyl-2,3-dihydroinden-1-ol?
The IUPAC name of 5-fluoro-1-prop-2-enyl-2,3-dihydroinden-1-ol (CID 116531622) is 5-fluoro-1-prop-2-enyl-2,3-dihydroinden-1-ol.
What is the SMILES notation for 5-fluoro-1-prop-2-enyl-2,3-dihydroinden-1-ol?
The canonical SMILES for 5-fluoro-1-prop-2-enyl-2,3-dihydroinden-1-ol is C=CCC1(O)CCc2cc(F)ccc21.
What is the InChIKey of 5-fluoro-1-prop-2-enyl-2,3-dihydroinden-1-ol?
The InChIKey is TZDQPHZCDDPFCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FO/c1-2-6-12(14)7-5-9-8-10(13)3-4-11(9)12/h2-4,8,14H,1,5-7H2.
What are the key properties of 5-fluoro-1-prop-2-enyl-2,3-dihydroinden-1-ol?
5-fluoro-1-prop-2-enyl-2,3-dihydroinden-1-ol has a molecular weight of 192.23 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-prop-2-enyl-2,3-dihydroinden-1-ol is sourced from PubChem (CID 116531622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).