C18H19FO — CID 116531708
5-fluoro-1-(4-propylphenyl)-2,3-dihydroinden-1-ol (PubChem CID 116531708) has the molecular formula C18H19FO and a molecular weight of 270.35 g/mol. Its IUPAC name is 5-fluoro-1-(4-propylphenyl)-2,3-dihydroinden-1-ol.
| Compound Name | 5-fluoro-1-(4-propylphenyl)-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 116531708 |
| Molecular Formula | C18H19FO |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 5-fluoro-1-(4-propylphenyl)-2,3-dihydroinden-1-ol |
| SMILES | CCCc1ccc(C2(O)CCc3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C18H19FO/c1-2-3-13-4-6-15(7-5-13)18(20)11-10-14-12-16(19)8-9-17(14)18/h4-9,12,20H,2-3,10-11H2,1H3 |
| InChIKey | TVHNMUIJVWPKID-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |