C18H23NO6 — CID 11653182
[(3R,3aR,6S,6aR)-6-(butylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] benzoate (PubChem CID 11653182) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is [(3R,3aR,6S,6aR)-6-(butylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] benzoate.
| Compound Name | [(3R,3aR,6S,6aR)-6-(butylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] benzoate |
|---|---|
| PubChem CID | 11653182 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [(3R,3aR,6S,6aR)-6-(butylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] benzoate |
| SMILES | CCCCNC(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H23NO6/c1-2-3-9-19-18(21)25-14-11-23-15-13(10-22-16(14)15)24-17(20)12-7-5-4-6-8-12/h4-8,13-16H,2-3,9-11H2,1H3,(H,19,21)/t13-,14+,15-,16-/m1/s1 |
| InChIKey | OPBYIALTDBGBEL-QKPAOTATSA-N |
| XLogP | 1.90 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|