About 1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydroinden-1-amine
1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydroinden-1-amine (PubChem CID 116531885) has the molecular formula C15H12Cl2FN
and a molecular weight of 296.17 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydroinden-1-amine.
Molecular Properties
| Compound Name | 1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydroinden-1-amine |
| PubChem CID | 116531885 |
| Molecular Formula | C15H12Cl2FN |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydroinden-1-amine |
| SMILES | NC1(c2ccc(Cl)c(Cl)c2)CCc2cc(F)ccc21 |
| InChI | InChI=1S/C15H12Cl2FN/c16-13-4-1-10(8-14(13)17)15(19)6-5-9-7-11(18)2-3-12(9)15/h1-4,7-8H,5-6,19H2 |
| InChIKey | UTBCKTBIFOYSCB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydroinden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydroinden-1-amine?
The IUPAC name of 1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydroinden-1-amine (CID 116531885) is 1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydroinden-1-amine.
What is the SMILES notation for 1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydroinden-1-amine?
The canonical SMILES for 1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydroinden-1-amine is NC1(c2ccc(Cl)c(Cl)c2)CCc2cc(F)ccc21.
What is the InChIKey of 1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydroinden-1-amine?
The InChIKey is UTBCKTBIFOYSCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2FN/c16-13-4-1-10(8-14(13)17)15(19)6-5-9-7-11(18)2-3-12(9)15/h1-4,7-8H,5-6,19H2.
What are the key properties of 1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydroinden-1-amine?
1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydroinden-1-amine has a molecular weight of 296.17 g/mol, XLogP of 4.28, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydroinden-1-amine is sourced from PubChem (CID 116531885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).