About 5-fluoro-1-[(2-methylpropylamino)methyl]-2,3-dihydroinden-1-ol
5-fluoro-1-[(2-methylpropylamino)methyl]-2,3-dihydroinden-1-ol (PubChem CID 116532263) has the molecular formula C14H20FNO
and a molecular weight of 237.32 g/mol. Its IUPAC name is 5-fluoro-1-[(2-methylpropylamino)methyl]-2,3-dihydroinden-1-ol.
Molecular Properties
| Compound Name | 5-fluoro-1-[(2-methylpropylamino)methyl]-2,3-dihydroinden-1-ol |
| PubChem CID | 116532263 |
| Molecular Formula | C14H20FNO |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 5-fluoro-1-[(2-methylpropylamino)methyl]-2,3-dihydroinden-1-ol |
| SMILES | CC(C)CNCC1(O)CCc2cc(F)ccc21 |
| InChI | InChI=1S/C14H20FNO/c1-10(2)8-16-9-14(17)6-5-11-7-12(15)3-4-13(11)14/h3-4,7,10,16-17H,5-6,8-9H2,1-2H3 |
| InChIKey | VGOWGEQUGIAFFP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-1-[(2-methylpropylamino)methyl]-2,3-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1-[(2-methylpropylamino)methyl]-2,3-dihydroinden-1-ol?
The IUPAC name of 5-fluoro-1-[(2-methylpropylamino)methyl]-2,3-dihydroinden-1-ol (CID 116532263) is 5-fluoro-1-[(2-methylpropylamino)methyl]-2,3-dihydroinden-1-ol.
What is the SMILES notation for 5-fluoro-1-[(2-methylpropylamino)methyl]-2,3-dihydroinden-1-ol?
The canonical SMILES for 5-fluoro-1-[(2-methylpropylamino)methyl]-2,3-dihydroinden-1-ol is CC(C)CNCC1(O)CCc2cc(F)ccc21.
What is the InChIKey of 5-fluoro-1-[(2-methylpropylamino)methyl]-2,3-dihydroinden-1-ol?
The InChIKey is VGOWGEQUGIAFFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FNO/c1-10(2)8-16-9-14(17)6-5-11-7-12(15)3-4-13(11)14/h3-4,7,10,16-17H,5-6,8-9H2,1-2H3.
What are the key properties of 5-fluoro-1-[(2-methylpropylamino)methyl]-2,3-dihydroinden-1-ol?
5-fluoro-1-[(2-methylpropylamino)methyl]-2,3-dihydroinden-1-ol has a molecular weight of 237.32 g/mol, XLogP of 2.21, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-[(2-methylpropylamino)methyl]-2,3-dihydroinden-1-ol is sourced from PubChem (CID 116532263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).