C10H6FNS2 — CID 116532289
6-fluoro-1,4-dihydroindeno[1,2-d][1,3]thiazole-2-thione (PubChem CID 116532289) has the molecular formula C10H6FNS2 and a molecular weight of 223.30 g/mol. Its IUPAC name is 6-fluoro-1,4-dihydroindeno[1,2-d][1,3]thiazole-2-thione.
| Compound Name | 6-fluoro-1,4-dihydroindeno[1,2-d][1,3]thiazole-2-thione |
|---|---|
| PubChem CID | 116532289 |
| Molecular Formula | C10H6FNS2 |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 222.99 |
| IUPAC Name | 6-fluoro-1,4-dihydroindeno[1,2-d][1,3]thiazole-2-thione |
| SMILES | Fc1ccc2c(c1)Cc1sc(=S)[nH]c1-2 |
| InChI | InChI=1S/C10H6FNS2/c11-6-1-2-7-5(3-6)4-8-9(7)12-10(13)14-8/h1-3H,4H2,(H,12,13) |
| InChIKey | NZBZQFVKNGSZTD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|