About 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-5-fluoro-2,3-dihydroinden-1-ol
1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-5-fluoro-2,3-dihydroinden-1-ol (PubChem CID 116532515) has the molecular formula C14H18FNO3S
and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-5-fluoro-2,3-dihydroinden-1-ol.
Molecular Properties
| Compound Name | 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-5-fluoro-2,3-dihydroinden-1-ol |
| PubChem CID | 116532515 |
| Molecular Formula | C14H18FNO3S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-5-fluoro-2,3-dihydroinden-1-ol |
| SMILES | NCC1(C2(O)CCc3cc(F)ccc32)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H18FNO3S/c15-11-1-2-12-10(7-11)3-4-14(12,17)13(8-16)5-6-20(18,19)9-13/h1-2,7,17H,3-6,8-9,16H2 |
| InChIKey | IUBNMKAYKZBAAD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-5-fluoro-2,3-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-5-fluoro-2,3-dihydroinden-1-ol?
The IUPAC name of 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-5-fluoro-2,3-dihydroinden-1-ol (CID 116532515) is 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-5-fluoro-2,3-dihydroinden-1-ol.
What is the SMILES notation for 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-5-fluoro-2,3-dihydroinden-1-ol?
The canonical SMILES for 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-5-fluoro-2,3-dihydroinden-1-ol is NCC1(C2(O)CCc3cc(F)ccc32)CCS(=O)(=O)C1.
What is the InChIKey of 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-5-fluoro-2,3-dihydroinden-1-ol?
The InChIKey is IUBNMKAYKZBAAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO3S/c15-11-1-2-12-10(7-11)3-4-14(12,17)13(8-16)5-6-20(18,19)9-13/h1-2,7,17H,3-6,8-9,16H2.
What are the key properties of 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-5-fluoro-2,3-dihydroinden-1-ol?
1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-5-fluoro-2,3-dihydroinden-1-ol has a molecular weight of 299.37 g/mol, XLogP of 0.72, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-5-fluoro-2,3-dihydroinden-1-ol is sourced from PubChem (CID 116532515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).