About 6-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine
6-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine (PubChem CID 116532528) has the molecular formula C14H18FN3O
and a molecular weight of 263.32 g/mol. Its IUPAC name is 6-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine.
Molecular Properties
| Compound Name | 6-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine |
| PubChem CID | 116532528 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 6-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine |
| SMILES | COCCN1C(N)=NCC12CCc1cc(F)ccc12 |
| InChI | InChI=1S/C14H18FN3O/c1-19-7-6-18-13(16)17-9-14(18)5-4-10-8-11(15)2-3-12(10)14/h2-3,8H,4-7,9H2,1H3,(H2,16,17) |
| InChIKey | CVFMEXAYMXAQNK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine?
The IUPAC name of 6-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine (CID 116532528) is 6-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine.
What is the SMILES notation for 6-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine?
The canonical SMILES for 6-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine is COCCN1C(N)=NCC12CCc1cc(F)ccc12.
What is the InChIKey of 6-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine?
The InChIKey is CVFMEXAYMXAQNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FN3O/c1-19-7-6-18-13(16)17-9-14(18)5-4-10-8-11(15)2-3-12(10)14/h2-3,8H,4-7,9H2,1H3,(H2,16,17).
What are the key properties of 6-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine?
6-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine has a molecular weight of 263.32 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine is sourced from PubChem (CID 116532528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).