C12H7FN2S — CID 116532606
5-fluoro-13-thia-10,15-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,11,14-hexaene (PubChem CID 116532606) has the molecular formula C12H7FN2S and a molecular weight of 230.27 g/mol. Its IUPAC name is 5-fluoro-13-thia-10,15-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,11,14-hexaene.
| Compound Name | 5-fluoro-13-thia-10,15-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,11,14-hexaene |
|---|---|
| PubChem CID | 116532606 |
| Molecular Formula | C12H7FN2S |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 5-fluoro-13-thia-10,15-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,11,14-hexaene |
| SMILES | Fc1ccc2c(c1)Cc1c-2nc2sccn12 |
| InChI | InChI=1S/C12H7FN2S/c13-8-1-2-9-7(5-8)6-10-11(9)14-12-15(10)3-4-16-12/h1-5H,6H2 |
| InChIKey | XOVZYSUQAFLTMY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |