C13H9FN2S — CID 116532607
5-fluoro-11-methyl-13-thia-10,15-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,11,14-hexaene (PubChem CID 116532607) has the molecular formula C13H9FN2S and a molecular weight of 244.29 g/mol. Its IUPAC name is 5-fluoro-11-methyl-13-thia-10,15-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,11,14-hexaene.
| Compound Name | 5-fluoro-11-methyl-13-thia-10,15-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,11,14-hexaene |
|---|---|
| PubChem CID | 116532607 |
| Molecular Formula | C13H9FN2S |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 5-fluoro-11-methyl-13-thia-10,15-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,11,14-hexaene |
| SMILES | Cc1csc2nc3c(n12)Cc1cc(F)ccc1-3 |
| InChI | InChI=1S/C13H9FN2S/c1-7-6-17-13-15-12-10-3-2-9(14)4-8(10)5-11(12)16(7)13/h2-4,6H,5H2,1H3 |
| InChIKey | GVLQHMJVJXNCRD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |