C18H30O5Si — CID 11653286
(1aR,2R,5R,7S,7aR)-2-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-5-propyl-1a,2,5,6,7,7a-hexahydrooxireno[2,3-g]isochromen-3-one (PubChem CID 11653286) has the molecular formula C18H30O5Si and a molecular weight of 354.52 g/mol. Its IUPAC name is (1aR,2R,5R,7S,7aR)-2-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-5-propyl-1a,2,5,6,7,7a-hexahydrooxireno[2,3-g]isochromen-3-one.
| Compound Name | (1aR,2R,5R,7S,7aR)-2-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-5-propyl-1a,2,5,6,7,7a-hexahydrooxireno[2,3-g]isochromen-3-one |
|---|---|
| PubChem CID | 11653286 |
| Molecular Formula | C18H30O5Si |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (1aR,2R,5R,7S,7aR)-2-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-5-propyl-1a,2,5,6,7,7a-hexahydrooxireno[2,3-g]isochromen-3-one |
| SMILES | CCC[C@@H]1CC2=C(C(=O)O1)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1[C@H]2O |
| InChI | InChI=1S/C18H30O5Si/c1-7-8-10-9-11-12(17(20)21-10)14(16-15(22-16)13(11)19)23-24(5,6)18(2,3)4/h10,13-16,19H,7-9H2,1-6H3/t10-,13+,14-,15-,16+/m1/s1 |
| InChIKey | IZFUGQXEZAXQDF-XNNBJJOUSA-N |
| XLogP | 2.93 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|