About 2-cyclopropyl-6-methyl-5,6-dihydrobenzo[h]quinoline-3-carboxylic acid
2-cyclopropyl-6-methyl-5,6-dihydrobenzo[h]quinoline-3-carboxylic acid (PubChem CID 116533757) has the molecular formula C18H17NO2
and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-cyclopropyl-6-methyl-5,6-dihydrobenzo[h]quinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-cyclopropyl-6-methyl-5,6-dihydrobenzo[h]quinoline-3-carboxylic acid |
| PubChem CID | 116533757 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-cyclopropyl-6-methyl-5,6-dihydrobenzo[h]quinoline-3-carboxylic acid |
| SMILES | CC1Cc2cc(C(=O)O)c(C3CC3)nc2-c2ccccc21 |
| InChI | InChI=1S/C18H17NO2/c1-10-8-12-9-15(18(20)21)16(11-6-7-11)19-17(12)14-5-3-2-4-13(10)14/h2-5,9-11H,6-8H2,1H3,(H,20,21) |
| InChIKey | BDUAYESSQUFMJJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopropyl-6-methyl-5,6-dihydrobenzo[h]quinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-6-methyl-5,6-dihydrobenzo[h]quinoline-3-carboxylic acid?
The IUPAC name of 2-cyclopropyl-6-methyl-5,6-dihydrobenzo[h]quinoline-3-carboxylic acid (CID 116533757) is 2-cyclopropyl-6-methyl-5,6-dihydrobenzo[h]quinoline-3-carboxylic acid.
What is the SMILES notation for 2-cyclopropyl-6-methyl-5,6-dihydrobenzo[h]quinoline-3-carboxylic acid?
The canonical SMILES for 2-cyclopropyl-6-methyl-5,6-dihydrobenzo[h]quinoline-3-carboxylic acid is CC1Cc2cc(C(=O)O)c(C3CC3)nc2-c2ccccc21.
What is the InChIKey of 2-cyclopropyl-6-methyl-5,6-dihydrobenzo[h]quinoline-3-carboxylic acid?
The InChIKey is BDUAYESSQUFMJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO2/c1-10-8-12-9-15(18(20)21)16(11-6-7-11)19-17(12)14-5-3-2-4-13(10)14/h2-5,9-11H,6-8H2,1H3,(H,20,21).
What are the key properties of 2-cyclopropyl-6-methyl-5,6-dihydrobenzo[h]quinoline-3-carboxylic acid?
2-cyclopropyl-6-methyl-5,6-dihydrobenzo[h]quinoline-3-carboxylic acid has a molecular weight of 279.34 g/mol, XLogP of 3.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-6-methyl-5,6-dihydrobenzo[h]quinoline-3-carboxylic acid is sourced from PubChem (CID 116533757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).