C20H24O6 — CID 11653392
[(1R,5R,9S)-1-[(1E)-2,6-dimethyl-5-oxohepta-1,6-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] acetate (PubChem CID 11653392) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is [(1R,5R,9S)-1-[(1E)-2,6-dimethyl-5-oxohepta-1,6-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] acetate.
| Compound Name | [(1R,5R,9S)-1-[(1E)-2,6-dimethyl-5-oxohepta-1,6-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] acetate |
|---|---|
| PubChem CID | 11653392 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | [(1R,5R,9S)-1-[(1E)-2,6-dimethyl-5-oxohepta-1,6-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] acetate |
| SMILES | C=C(C)C(=O)CC/C(C)=C/[C@H]1OC(=O)C[C@]12C[C@H](OC(C)=O)C=CC2=O |
| InChI | InChI=1S/C20H24O6/c1-12(2)16(22)7-5-13(3)9-18-20(11-19(24)26-18)10-15(25-14(4)21)6-8-17(20)23/h6,8-9,15,18H,1,5,7,10-11H2,2-4H3/b13-9+/t15-,18-,20+/m1/s1 |
| InChIKey | LMLJUECRBQYQEU-BIPLCGTOSA-N |
| XLogP | 2.62 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|