C18H13ClO6 — CID 11653403
(1R,2S,3R)-3-chloro-1,2,6,7-tetrahydroxy-3-methyl-1,2-dihydrobenzo[a]fluorene-4,11-dione (PubChem CID 11653403) has the molecular formula C18H13ClO6 and a molecular weight of 360.75 g/mol. Its IUPAC name is (1R,2S,3R)-3-chloro-1,2,6,7-tetrahydroxy-3-methyl-1,2-dihydrobenzo[a]fluorene-4,11-dione.
| Compound Name | (1R,2S,3R)-3-chloro-1,2,6,7-tetrahydroxy-3-methyl-1,2-dihydrobenzo[a]fluorene-4,11-dione |
|---|---|
| PubChem CID | 11653403 |
| Molecular Formula | C18H13ClO6 |
| Molecular Weight | 360.75 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | (1R,2S,3R)-3-chloro-1,2,6,7-tetrahydroxy-3-methyl-1,2-dihydrobenzo[a]fluorene-4,11-dione |
| SMILES | C[C@]1(Cl)C(=O)c2cc(O)c3c(c2[C@@H](O)[C@@H]1O)C(=O)c1cccc(O)c1-3 |
| InChI | InChI=1S/C18H13ClO6/c1-18(19)16(24)7-5-9(21)12-10-6(3-2-4-8(10)20)14(22)13(12)11(7)15(23)17(18)25/h2-5,15,17,20-21,23,25H,1H3/t15-,17+,18+/m1/s1 |
| InChIKey | WXDSJSLCLHLHSW-NJAFHUGGSA-N |
| XLogP | 1.90 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.75 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|