About (2S)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]pyrrolidine-2-carboxylic acid
(2S)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]pyrrolidine-2-carboxylic acid (PubChem CID 11653425) has the molecular formula C19H23NO2S2
and a molecular weight of 361.53 g/mol. Its IUPAC name is (2S)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]pyrrolidine-2-carboxylic acid |
| PubChem CID | 11653425 |
| Molecular Formula | C19H23NO2S2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (2S)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cc1ccsc1C(=CCCN1CCC[C@H]1C(=O)O)c1sccc1C |
| InChI | InChI=1S/C19H23NO2S2/c1-13-7-11-23-17(13)15(18-14(2)8-12-24-18)5-3-9-20-10-4-6-16(20)19(21)22/h5,7-8,11-12,16H,3-4,6,9-10H2,1-2H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | XBTCVKGYDAMJGM-INIZCTEOSA-N |
| XLogP | 4.80 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]pyrrolidine-2-carboxylic acid?
The IUPAC name of (2S)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]pyrrolidine-2-carboxylic acid (CID 11653425) is (2S)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]pyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2S)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]pyrrolidine-2-carboxylic acid?
The canonical SMILES for (2S)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]pyrrolidine-2-carboxylic acid is Cc1ccsc1C(=CCCN1CCC[C@H]1C(=O)O)c1sccc1C.
What is the InChIKey of (2S)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]pyrrolidine-2-carboxylic acid?
The InChIKey is XBTCVKGYDAMJGM-INIZCTEOSA-N. The full InChI is InChI=1S/C19H23NO2S2/c1-13-7-11-23-17(13)15(18-14(2)8-12-24-18)5-3-9-20-10-4-6-16(20)19(21)22/h5,7-8,11-12,16H,3-4,6,9-10H2,1-2H3,(H,21,22)/t16-/m0/s1.
What are the key properties of (2S)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]pyrrolidine-2-carboxylic acid?
(2S)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]pyrrolidine-2-carboxylic acid has a molecular weight of 361.53 g/mol, XLogP of 4.80, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 11653425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).