C12H12Cl2F3N3S — CID 116534479
3,5-dichloro-N-(6,6,6-trifluorohexan-2-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine (PubChem CID 116534479) has the molecular formula C12H12Cl2F3N3S and a molecular weight of 358.22 g/mol. Its IUPAC name is 3,5-dichloro-N-(6,6,6-trifluorohexan-2-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine.
| Compound Name | 3,5-dichloro-N-(6,6,6-trifluorohexan-2-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
|---|---|
| PubChem CID | 116534479 |
| Molecular Formula | C12H12Cl2F3N3S |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 3,5-dichloro-N-(6,6,6-trifluorohexan-2-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
| SMILES | CC(CCCC(F)(F)F)Nc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C12H12Cl2F3N3S/c1-6(3-2-4-12(15,16)17)18-9-7(13)5-8(14)10-11(9)20-21-19-10/h5-6,18H,2-4H2,1H3 |
| InChIKey | NRDPHXONOFXPDN-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |