About 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexane-1-carboxamide
4-(6,6,6-trifluorohexan-2-ylamino)cyclohexane-1-carboxamide (PubChem CID 116534518) has the molecular formula C13H23F3N2O
and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexane-1-carboxamide |
| PubChem CID | 116534518 |
| Molecular Formula | C13H23F3N2O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexane-1-carboxamide |
| SMILES | CC(CCCC(F)(F)F)NC1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C13H23F3N2O/c1-9(3-2-8-13(14,15)16)18-11-6-4-10(5-7-11)12(17)19/h9-11,18H,2-8H2,1H3,(H2,17,19) |
| InChIKey | DRQNEXHXBAKXAA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexane-1-carboxamide?
The IUPAC name of 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexane-1-carboxamide (CID 116534518) is 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexane-1-carboxamide.
What is the SMILES notation for 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexane-1-carboxamide?
The canonical SMILES for 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexane-1-carboxamide is CC(CCCC(F)(F)F)NC1CCC(C(N)=O)CC1.
What is the InChIKey of 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexane-1-carboxamide?
The InChIKey is DRQNEXHXBAKXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23F3N2O/c1-9(3-2-8-13(14,15)16)18-11-6-4-10(5-7-11)12(17)19/h9-11,18H,2-8H2,1H3,(H2,17,19).
What are the key properties of 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexane-1-carboxamide?
4-(6,6,6-trifluorohexan-2-ylamino)cyclohexane-1-carboxamide has a molecular weight of 280.33 g/mol, XLogP of 2.74, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexane-1-carboxamide is sourced from PubChem (CID 116534518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).