About 4-methyl-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine
4-methyl-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine (PubChem CID 116535090) has the molecular formula C10H16F3N3
and a molecular weight of 235.25 g/mol. Its IUPAC name is 4-methyl-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-methyl-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine |
| PubChem CID | 116535090 |
| Molecular Formula | C10H16F3N3 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 4-methyl-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine |
| SMILES | Cc1cnn(C(C)CCCC(F)(F)F)c1N |
| InChI | InChI=1S/C10H16F3N3/c1-7-6-15-16(9(7)14)8(2)4-3-5-10(11,12)13/h6,8H,3-5,14H2,1-2H3 |
| InChIKey | LQHNJTRHOUIIGI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine?
The IUPAC name of 4-methyl-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine (CID 116535090) is 4-methyl-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine.
What is the SMILES notation for 4-methyl-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine?
The canonical SMILES for 4-methyl-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine is Cc1cnn(C(C)CCCC(F)(F)F)c1N.
What is the InChIKey of 4-methyl-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine?
The InChIKey is LQHNJTRHOUIIGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3N3/c1-7-6-15-16(9(7)14)8(2)4-3-5-10(11,12)13/h6,8H,3-5,14H2,1-2H3.
What are the key properties of 4-methyl-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine?
4-methyl-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine has a molecular weight of 235.25 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine is sourced from PubChem (CID 116535090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).