C9H13ClF3N3 — CID 116535092
4-chloro-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine (PubChem CID 116535092) has the molecular formula C9H13ClF3N3 and a molecular weight of 255.67 g/mol. Its IUPAC name is 4-chloro-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine.
| Compound Name | 4-chloro-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine |
|---|---|
| PubChem CID | 116535092 |
| Molecular Formula | C9H13ClF3N3 |
| Molecular Weight | 255.67 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 4-chloro-1-(6,6,6-trifluorohexan-2-yl)pyrazol-5-amine |
| SMILES | CC(CCCC(F)(F)F)n1ncc(Cl)c1N |
| InChI | InChI=1S/C9H13ClF3N3/c1-6(3-2-4-9(11,12)13)16-8(14)7(10)5-15-16/h5-6H,2-4,14H2,1H3 |
| InChIKey | GMNMQFJTCPWAOO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.67 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |