C16H29F3N2 — CID 116535170
2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6,6,6-trifluoro-2-methylhexan-1-amine (PubChem CID 116535170) has the molecular formula C16H29F3N2 and a molecular weight of 306.42 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6,6,6-trifluoro-2-methylhexan-1-amine.
| Compound Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6,6,6-trifluoro-2-methylhexan-1-amine |
|---|---|
| PubChem CID | 116535170 |
| Molecular Formula | C16H29F3N2 |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6,6,6-trifluoro-2-methylhexan-1-amine |
| SMILES | CC(CN)(CCCC(F)(F)F)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C16H29F3N2/c1-15(12-20,9-5-10-16(17,18)19)21-11-4-7-13-6-2-3-8-14(13)21/h13-14H,2-12,20H2,1H3 |
| InChIKey | IUGQYNDBLFVDAF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |