C12H25F3N2O — CID 116535393
2-N-(2-ethoxyethyl)-6,6,6-trifluoro-2-N,2-dimethylhexane-1,2-diamine (PubChem CID 116535393) has the molecular formula C12H25F3N2O and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-N-(2-ethoxyethyl)-6,6,6-trifluoro-2-N,2-dimethylhexane-1,2-diamine.
| Compound Name | 2-N-(2-ethoxyethyl)-6,6,6-trifluoro-2-N,2-dimethylhexane-1,2-diamine |
|---|---|
| PubChem CID | 116535393 |
| Molecular Formula | C12H25F3N2O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 2-N-(2-ethoxyethyl)-6,6,6-trifluoro-2-N,2-dimethylhexane-1,2-diamine |
| SMILES | CCOCCN(C)C(C)(CN)CCCC(F)(F)F |
| InChI | InChI=1S/C12H25F3N2O/c1-4-18-9-8-17(3)11(2,10-16)6-5-7-12(13,14)15/h4-10,16H2,1-3H3 |
| InChIKey | QWBCDGQDWDTCSQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|