C15H23F3N2S — CID 116535739
N-ethyl-6,6,6-trifluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)hexan-2-amine (PubChem CID 116535739) has the molecular formula C15H23F3N2S and a molecular weight of 320.42 g/mol. Its IUPAC name is N-ethyl-6,6,6-trifluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)hexan-2-amine.
| Compound Name | N-ethyl-6,6,6-trifluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)hexan-2-amine |
|---|---|
| PubChem CID | 116535739 |
| Molecular Formula | C15H23F3N2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-ethyl-6,6,6-trifluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)hexan-2-amine |
| SMILES | CCNC(C)(CCCC(F)(F)F)c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C15H23F3N2S/c1-3-19-14(2,9-6-10-15(16,17)18)13-20-11-7-4-5-8-12(11)21-13/h19H,3-10H2,1-2H3 |
| InChIKey | BBGCRTBFOVANOT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |