C15H25F3N2O — CID 116535858
6,6,6-trifluoro-2-methyl-1-(1-pentan-3-ylpyrazol-3-yl)hexan-2-ol (PubChem CID 116535858) has the molecular formula C15H25F3N2O and a molecular weight of 306.37 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-methyl-1-(1-pentan-3-ylpyrazol-3-yl)hexan-2-ol.
| Compound Name | 6,6,6-trifluoro-2-methyl-1-(1-pentan-3-ylpyrazol-3-yl)hexan-2-ol |
|---|---|
| PubChem CID | 116535858 |
| Molecular Formula | C15H25F3N2O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 6,6,6-trifluoro-2-methyl-1-(1-pentan-3-ylpyrazol-3-yl)hexan-2-ol |
| SMILES | CCC(CC)n1ccc(CC(C)(O)CCCC(F)(F)F)n1 |
| InChI | InChI=1S/C15H25F3N2O/c1-4-13(5-2)20-10-7-12(19-20)11-14(3,21)8-6-9-15(16,17)18/h7,10,13,21H,4-6,8-9,11H2,1-3H3 |
| InChIKey | BUNYSDXBMKJZMV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |