C10H14F3NOS — CID 116535903
6,6,6-trifluoro-2-methyl-1-(1,3-thiazol-5-yl)hexan-2-ol (PubChem CID 116535903) has the molecular formula C10H14F3NOS and a molecular weight of 253.29 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-methyl-1-(1,3-thiazol-5-yl)hexan-2-ol.
| Compound Name | 6,6,6-trifluoro-2-methyl-1-(1,3-thiazol-5-yl)hexan-2-ol |
|---|---|
| PubChem CID | 116535903 |
| Molecular Formula | C10H14F3NOS |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 6,6,6-trifluoro-2-methyl-1-(1,3-thiazol-5-yl)hexan-2-ol |
| SMILES | CC(O)(CCCC(F)(F)F)Cc1cncs1 |
| InChI | InChI=1S/C10H14F3NOS/c1-9(15,3-2-4-10(11,12)13)5-8-6-14-7-16-8/h6-7,15H,2-5H2,1H3 |
| InChIKey | YDGOJYHXWUTDDL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |