C12H17F3N2O3 — CID 116535906
2-(3,5-dimethoxypyrazin-2-yl)-6,6,6-trifluorohexan-2-ol (PubChem CID 116535906) has the molecular formula C12H17F3N2O3 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-(3,5-dimethoxypyrazin-2-yl)-6,6,6-trifluorohexan-2-ol.
| Compound Name | 2-(3,5-dimethoxypyrazin-2-yl)-6,6,6-trifluorohexan-2-ol |
|---|---|
| PubChem CID | 116535906 |
| Molecular Formula | C12H17F3N2O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-(3,5-dimethoxypyrazin-2-yl)-6,6,6-trifluorohexan-2-ol |
| SMILES | COc1cnc(C(C)(O)CCCC(F)(F)F)c(OC)n1 |
| InChI | InChI=1S/C12H17F3N2O3/c1-11(18,5-4-6-12(13,14)15)9-10(20-3)17-8(19-2)7-16-9/h7,18H,4-6H2,1-3H3 |
| InChIKey | VEEJAIXVIPNIIX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |