C14H18F3NO — CID 116536013
2-(2,3-dihydro-1H-indol-2-yl)-6,6,6-trifluorohexan-2-ol (PubChem CID 116536013) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-indol-2-yl)-6,6,6-trifluorohexan-2-ol.
| Compound Name | 2-(2,3-dihydro-1H-indol-2-yl)-6,6,6-trifluorohexan-2-ol |
|---|---|
| PubChem CID | 116536013 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-(2,3-dihydro-1H-indol-2-yl)-6,6,6-trifluorohexan-2-ol |
| SMILES | CC(O)(CCCC(F)(F)F)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C14H18F3NO/c1-13(19,7-4-8-14(15,16)17)12-9-10-5-2-3-6-11(10)18-12/h2-3,5-6,12,18-19H,4,7-9H2,1H3 |
| InChIKey | GKNKPHALNGCWCK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |