C11H17F3N2O — CID 116536039
6,6,6-trifluoro-2-methyl-2-morpholin-4-ylhexanenitrile (PubChem CID 116536039) has the molecular formula C11H17F3N2O and a molecular weight of 250.26 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-methyl-2-morpholin-4-ylhexanenitrile.
| Compound Name | 6,6,6-trifluoro-2-methyl-2-morpholin-4-ylhexanenitrile |
|---|---|
| PubChem CID | 116536039 |
| Molecular Formula | C11H17F3N2O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 6,6,6-trifluoro-2-methyl-2-morpholin-4-ylhexanenitrile |
| SMILES | CC(C#N)(CCCC(F)(F)F)N1CCOCC1 |
| InChI | InChI=1S/C11H17F3N2O/c1-10(9-15,3-2-4-11(12,13)14)16-5-7-17-8-6-16/h2-8H2,1H3 |
| InChIKey | BRFYRLAUWUYJJZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |