About 3-propyl-1-(6,6,6-trifluorohexan-2-yl)pyrrolidine-3-carboxylic acid
3-propyl-1-(6,6,6-trifluorohexan-2-yl)pyrrolidine-3-carboxylic acid (PubChem CID 116536211) has the molecular formula C14H24F3NO2
and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-propyl-1-(6,6,6-trifluorohexan-2-yl)pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-propyl-1-(6,6,6-trifluorohexan-2-yl)pyrrolidine-3-carboxylic acid |
| PubChem CID | 116536211 |
| Molecular Formula | C14H24F3NO2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 3-propyl-1-(6,6,6-trifluorohexan-2-yl)pyrrolidine-3-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCN(C(C)CCCC(F)(F)F)C1 |
| InChI | InChI=1S/C14H24F3NO2/c1-3-6-13(12(19)20)8-9-18(10-13)11(2)5-4-7-14(15,16)17/h11H,3-10H2,1-2H3,(H,19,20) |
| InChIKey | MMQVCCYFABNIFN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propyl-1-(6,6,6-trifluorohexan-2-yl)pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-1-(6,6,6-trifluorohexan-2-yl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 3-propyl-1-(6,6,6-trifluorohexan-2-yl)pyrrolidine-3-carboxylic acid (CID 116536211) is 3-propyl-1-(6,6,6-trifluorohexan-2-yl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 3-propyl-1-(6,6,6-trifluorohexan-2-yl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 3-propyl-1-(6,6,6-trifluorohexan-2-yl)pyrrolidine-3-carboxylic acid is CCCC1(C(=O)O)CCN(C(C)CCCC(F)(F)F)C1.
What is the InChIKey of 3-propyl-1-(6,6,6-trifluorohexan-2-yl)pyrrolidine-3-carboxylic acid?
The InChIKey is MMQVCCYFABNIFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24F3NO2/c1-3-6-13(12(19)20)8-9-18(10-13)11(2)5-4-7-14(15,16)17/h11H,3-10H2,1-2H3,(H,19,20).
What are the key properties of 3-propyl-1-(6,6,6-trifluorohexan-2-yl)pyrrolidine-3-carboxylic acid?
3-propyl-1-(6,6,6-trifluorohexan-2-yl)pyrrolidine-3-carboxylic acid has a molecular weight of 295.34 g/mol, XLogP of 3.68, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-1-(6,6,6-trifluorohexan-2-yl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 116536211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).