About 2-[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-6,6,6-trifluorohexan-2-ol
2-[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-6,6,6-trifluorohexan-2-ol (PubChem CID 116536390) has the molecular formula C13H22F3NO2
and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-6,6,6-trifluorohexan-2-ol.
Molecular Properties
| Compound Name | 2-[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-6,6,6-trifluorohexan-2-ol |
| PubChem CID | 116536390 |
| Molecular Formula | C13H22F3NO2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-6,6,6-trifluorohexan-2-ol |
| SMILES | CC(O)(CCCC(F)(F)F)C1(CN)CC2CCC1O2 |
| InChI | InChI=1S/C13H22F3NO2/c1-11(18,5-2-6-13(14,15)16)12(8-17)7-9-3-4-10(12)19-9/h9-10,18H,2-8,17H2,1H3 |
| InChIKey | IZLMNHOTBDFEQU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-6,6,6-trifluorohexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-6,6,6-trifluorohexan-2-ol?
The IUPAC name of 2-[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-6,6,6-trifluorohexan-2-ol (CID 116536390) is 2-[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-6,6,6-trifluorohexan-2-ol.
What is the SMILES notation for 2-[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-6,6,6-trifluorohexan-2-ol?
The canonical SMILES for 2-[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-6,6,6-trifluorohexan-2-ol is CC(O)(CCCC(F)(F)F)C1(CN)CC2CCC1O2.
What is the InChIKey of 2-[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-6,6,6-trifluorohexan-2-ol?
The InChIKey is IZLMNHOTBDFEQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F3NO2/c1-11(18,5-2-6-13(14,15)16)12(8-17)7-9-3-4-10(12)19-9/h9-10,18H,2-8,17H2,1H3.
What are the key properties of 2-[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-6,6,6-trifluorohexan-2-ol?
2-[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-6,6,6-trifluorohexan-2-ol has a molecular weight of 281.32 g/mol, XLogP of 2.37, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-6,6,6-trifluorohexan-2-ol is sourced from PubChem (CID 116536390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).