C9H14F3N3O — CID 116536457
4-amino-1,5-dimethyl-5-(4,4,4-trifluorobutyl)imidazol-2-one (PubChem CID 116536457) has the molecular formula C9H14F3N3O and a molecular weight of 237.22 g/mol. Its IUPAC name is 4-amino-1,5-dimethyl-5-(4,4,4-trifluorobutyl)imidazol-2-one.
| Compound Name | 4-amino-1,5-dimethyl-5-(4,4,4-trifluorobutyl)imidazol-2-one |
|---|---|
| PubChem CID | 116536457 |
| Molecular Formula | C9H14F3N3O |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 4-amino-1,5-dimethyl-5-(4,4,4-trifluorobutyl)imidazol-2-one |
| SMILES | CN1C(=O)N=C(N)C1(C)CCCC(F)(F)F |
| InChI | InChI=1S/C9H14F3N3O/c1-8(4-3-5-9(10,11)12)6(13)14-7(16)15(8)2/h3-5H2,1-2H3,(H2,13,14,16) |
| InChIKey | YEHUTWAMOKAEFE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |