C11H16F3N3O — CID 116536460
4-amino-5-methyl-1-prop-2-enyl-5-(4,4,4-trifluorobutyl)imidazol-2-one (PubChem CID 116536460) has the molecular formula C11H16F3N3O and a molecular weight of 263.26 g/mol. Its IUPAC name is 4-amino-5-methyl-1-prop-2-enyl-5-(4,4,4-trifluorobutyl)imidazol-2-one.
| Compound Name | 4-amino-5-methyl-1-prop-2-enyl-5-(4,4,4-trifluorobutyl)imidazol-2-one |
|---|---|
| PubChem CID | 116536460 |
| Molecular Formula | C11H16F3N3O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 4-amino-5-methyl-1-prop-2-enyl-5-(4,4,4-trifluorobutyl)imidazol-2-one |
| SMILES | C=CCN1C(=O)N=C(N)C1(C)CCCC(F)(F)F |
| InChI | InChI=1S/C11H16F3N3O/c1-3-7-17-9(18)16-8(15)10(17,2)5-4-6-11(12,13)14/h3H,1,4-7H2,2H3,(H2,15,16,18) |
| InChIKey | VXBVMWPLEPWVBH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|