C8H11F3N2O2 — CID 116536479
2-amino-5-methyl-5-(4,4,4-trifluorobutyl)-1,3-oxazol-4-one (PubChem CID 116536479) has the molecular formula C8H11F3N2O2 and a molecular weight of 224.18 g/mol. Its IUPAC name is 2-amino-5-methyl-5-(4,4,4-trifluorobutyl)-1,3-oxazol-4-one.
| Compound Name | 2-amino-5-methyl-5-(4,4,4-trifluorobutyl)-1,3-oxazol-4-one |
|---|---|
| PubChem CID | 116536479 |
| Molecular Formula | C8H11F3N2O2 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-amino-5-methyl-5-(4,4,4-trifluorobutyl)-1,3-oxazol-4-one |
| SMILES | CC1(CCCC(F)(F)F)OC(N)=NC1=O |
| InChI | InChI=1S/C8H11F3N2O2/c1-7(3-2-4-8(9,10)11)5(14)13-6(12)15-7/h2-4H2,1H3,(H2,12,13,14) |
| InChIKey | JNYGVONNTAHGGZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |