C11H19NO5S — CID 116536763
2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-3,3-dimethylbutanoic acid (PubChem CID 116536763) has the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-3,3-dimethylbutanoic acid.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 116536763 |
| Molecular Formula | C11H19NO5S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)C(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H19NO5S/c1-11(2,3)8(10(14)15)9(13)12-4-6-18(16,17)7-5-12/h8H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | IZQCQUCJVWJUSO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|