C11H18F3NO3 — CID 116537267
3,3-dimethyl-2-[methyl(3,3,3-trifluoropropyl)carbamoyl]butanoic acid (PubChem CID 116537267) has the molecular formula C11H18F3NO3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 3,3-dimethyl-2-[methyl(3,3,3-trifluoropropyl)carbamoyl]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[methyl(3,3,3-trifluoropropyl)carbamoyl]butanoic acid |
|---|---|
| PubChem CID | 116537267 |
| Molecular Formula | C11H18F3NO3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3,3-dimethyl-2-[methyl(3,3,3-trifluoropropyl)carbamoyl]butanoic acid |
| SMILES | CN(CCC(F)(F)F)C(=O)C(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H18F3NO3/c1-10(2,3)7(9(17)18)8(16)15(4)6-5-11(12,13)14/h7H,5-6H2,1-4H3,(H,17,18) |
| InChIKey | NWKSIUMJBUNIRA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|