C15H23N3O3 — CID 116538037
ethyl 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carbonyl)-3,3-dimethylbutanoate (PubChem CID 116538037) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is ethyl 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carbonyl)-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carbonyl)-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 116538037 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | ethyl 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carbonyl)-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)N1CCn2ccnc2C1)C(C)(C)C |
| InChI | InChI=1S/C15H23N3O3/c1-5-21-14(20)12(15(2,3)4)13(19)18-9-8-17-7-6-16-11(17)10-18/h6-7,12H,5,8-10H2,1-4H3 |
| InChIKey | XSWDIFRVTHHYPD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|