C13H22F3NO3 — CID 116538223
ethyl 3,3-dimethyl-2-(4,4,4-trifluorobutylcarbamoyl)butanoate (PubChem CID 116538223) has the molecular formula C13H22F3NO3 and a molecular weight of 297.32 g/mol. Its IUPAC name is ethyl 3,3-dimethyl-2-(4,4,4-trifluorobutylcarbamoyl)butanoate.
| Compound Name | ethyl 3,3-dimethyl-2-(4,4,4-trifluorobutylcarbamoyl)butanoate |
|---|---|
| PubChem CID | 116538223 |
| Molecular Formula | C13H22F3NO3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | ethyl 3,3-dimethyl-2-(4,4,4-trifluorobutylcarbamoyl)butanoate |
| SMILES | CCOC(=O)C(C(=O)NCCCC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C13H22F3NO3/c1-5-20-11(19)9(12(2,3)4)10(18)17-8-6-7-13(14,15)16/h9H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | UXSMMSFARHMUDO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|